@article{1c1225986a1b445bbdba34de7b8dbd24,
title = "A linear metal string [Cr7(μ7-teptra)4Cl2] complex with delocalized heptachromium(II) multiple bonds (teptraH3 = tetrapyridyltriamine)",
abstract = "A heptachromium(II) metal chain helically wrapped by four all-syn type teptra3- ligands with delocalized Cr(II)-Cr(II)-Cr(II)-Cr(II)-Cr(II)-Cr(II)-Cr(II) multiple bonds is found in the complex [Cr7(μ7-teptra)4Cl2]. The band structure of a hypothetical one-dimensional chromium string based on this structure is calculated and shows metallic behavior for the string structure.",
author = "Chen, \{Yu Hua\} and Lee, \{Chung Chou\} and Wang, \{Chih Chieh\} and Lee, \{Gene Hsiang\} and Lai, \{Shie Yang\} and Li, \{Feng Yin\} and Mou, \{Chung Yuan\} and Peng, \{Shie Ming\}",
note = "Funding Information: This work was supported by a Japan Society for the Promotion of Science (JSPS) Grant-in-Aid for Scientific Research, Grant Number 25871226.",
year = "1999",
month = sep,
day = "7",
doi = "10.1039/a905001i",
language = "English",
pages = "1667--1668",
journal = "Chemical Communications",
issn = "1359-7345",
publisher = "Royal Society of Chemistry",
number = "17",
}