@article{1c1225986a1b445bbdba34de7b8dbd24,
title = "A linear metal string [Cr7(μ7-teptra)4Cl2] complex with delocalized heptachromium(II) multiple bonds (teptraH3 = tetrapyridyltriamine)",
abstract = "A heptachromium(II) metal chain helically wrapped by four all-syn type teptra3- ligands with delocalized Cr(II)-Cr(II)-Cr(II)-Cr(II)-Cr(II)-Cr(II)-Cr(II) multiple bonds is found in the complex [Cr7(μ7-teptra)4Cl2]. The band structure of a hypothetical one-dimensional chromium string based on this structure is calculated and shows metallic behavior for the string structure.",
author = "Chen, {Yu Hua} and Lee, {Chung Chou} and Wang, {Chih Chieh} and Lee, {Gene Hsiang} and Lai, {Shie Yang} and Li, {Feng Yin} and Mou, {Chung Yuan} and Peng, {Shie Ming}",
note = "Funding Information: This work was supported by a Japan Society for the Promotion of Science (JSPS) Grant-in-Aid for Scientific Research, Grant Number 25871226.",
year = "1999",
month = sep,
day = "7",
doi = "10.1039/a905001i",
language = "English",
pages = "1667--1668",
journal = "Chemical Communications",
issn = "1359-7345",
publisher = "Royal Society of Chemistry",
number = "17",
}